/** A unit test for JUnit */
@Test
public void testAlanin() throws Exception {
HydrogenPlacer hydrogenPlacer = new HydrogenPlacer();
IAtomContainer mol1 = new AtomContainer();
SmilesGenerator sg = new SmilesGenerator();
mol1.addAtom(new Atom("N", new Point2d(1, 0)));
// 1
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 2
mol1.addAtom(new Atom("F", new Point2d(1, 2)));
// 3
mol1.addAtom(new Atom("C", new Point2d(0, 0)));
// 4
mol1.addAtom(new Atom("C", new Point2d(1, 4)));
// 5
mol1.addAtom(new Atom("O", new Point2d(1, 5)));
// 6
mol1.addAtom(new Atom("O", new Point2d(1, 6)));
// 7
mol1.addBond(0, 1, IBond.Order.SINGLE);
// 1
mol1.addBond(1, 2, IBond.Order.SINGLE, IBond.Stereo.UP);
// 2
mol1.addBond(1, 3, IBond.Order.SINGLE, IBond.Stereo.DOWN);
// 3
mol1.addBond(1, 4, IBond.Order.SINGLE);
// 4
mol1.addBond(4, 5, IBond.Order.SINGLE);
// 5
mol1.addBond(4, 6, IBond.Order.DOUBLE);
// 6
addExplicitHydrogens(mol1);
hydrogenPlacer.placeHydrogens2D(mol1, 1.0);
IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder());
ifac.configureAtoms(mol1);
String smiles1 = null;
if (standAlone) {
display(mol1);
}
smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]);
if (standAlone) {
System.err.println("SMILES 1: " + smiles1);
}
Assert.assertNotNull(smiles1);
Assert.assertEquals("[H]OC(=O)[C@](F)(N([H])[H])C([H])([H])[H]", smiles1);
mol1.getBond(1).setStereo(IBond.Stereo.DOWN);
mol1.getBond(2).setStereo(IBond.Stereo.UP);
smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]);
if (standAlone) {
System.err.println("SMILES 1: " + smiles1);
}
Assert.assertNotNull(smiles1);
Assert.assertEquals("[H]OC(=O)[C@](F)(C([H])([H])[H])N([H])[H]", smiles1);
}
/**
* Get the summed natural mass of all elements from an MolecularFormula.
*
* @param formula The IMolecularFormula to calculate
* @return The summed exact mass of all atoms in this MolecularFormula
*/
public static double getNaturalExactMass(IMolecularFormula formula) {
double mass = 0.0;
IsotopeFactory factory;
try {
factory = Isotopes.getInstance();
} catch (IOException e) {
throw new RuntimeException("Could not instantiate the IsotopeFactory.");
}
for (IIsotope isotope : formula.isotopes()) {
IElement isotopesElement = formula.getBuilder().newInstance(IElement.class, isotope);
mass += factory.getNaturalMass(isotopesElement) * formula.getIsotopeCount(isotope);
}
return mass;
}
/**
* Get the summed major isotopic mass of all elements from an MolecularFormula.
*
* @param formula The IMolecularFormula to calculate
* @return The summed exact major isotope masses of all atoms in this MolecularFormula
*/
public static double getMajorIsotopeMass(IMolecularFormula formula) {
double mass = 0.0;
IsotopeFactory factory;
try {
factory = Isotopes.getInstance();
} catch (IOException e) {
throw new RuntimeException("Could not instantiate the IsotopeFactory.");
}
for (IIsotope isotope : formula.isotopes()) {
IIsotope major = factory.getMajorIsotope(isotope.getSymbol());
if (major != null) {
mass += major.getExactMass() * formula.getIsotopeCount(isotope);
}
}
return mass;
}
private void fixHydrogenIsotopes(IAtomContainer molecule, IsotopeFactory isotopeFactory) {
for (IAtom atom : AtomContainerManipulator.getAtomArray(molecule)) {
if (atom instanceof IPseudoAtom) {
IPseudoAtom pseudo = (IPseudoAtom) atom;
if ("D".equals(pseudo.getLabel())) {
IAtom newAtom = molecule.getBuilder().newInstance(IAtom.class, atom);
newAtom.setSymbol("H");
newAtom.setAtomicNumber(1);
isotopeFactory.configure(newAtom, isotopeFactory.getIsotope("H", 2));
AtomContainerManipulator.replaceAtomByAtom(molecule, atom, newAtom);
} else if ("T".equals(pseudo.getLabel())) {
IAtom newAtom = molecule.getBuilder().newInstance(IAtom.class, atom);
newAtom.setSymbol("H");
newAtom.setAtomicNumber(1);
isotopeFactory.configure(newAtom, isotopeFactory.getIsotope("H", 3));
AtomContainerManipulator.replaceAtomByAtom(molecule, atom, newAtom);
}
}
}
}
/**
* Loads one or more files into IAtomContainer objects.
*
* <p>This method does not need knowledge of the format since it is autodetected. Note that if
* aromaticity detection or atom typing is specified and fails for a specific molecule, that
* molecule will be set to <i>null</i>
*
* @param filenames An array of String's containing the filenames of the structures we want to
* load
* @param doAromaticity If true, then aromaticity perception is performed
* @param doTyping If true, atom typing and configuration is performed. This will use the internal
* CDK atom typing scheme
* @return An array of AtoContainer's
* @throws CDKException if there is an error when reading a file
*/
public static IAtomContainer[] loadMolecules(
String[] filenames, boolean doAromaticity, boolean doTyping, boolean doIsotopes)
throws CDKException, IOException {
Vector<IAtomContainer> v = new Vector<IAtomContainer>();
IChemObjectBuilder builder = DefaultChemObjectBuilder.getInstance();
try {
int i;
int j;
for (i = 0; i < filenames.length; i++) {
File input = new File(filenames[i]);
ReaderFactory readerFactory = new ReaderFactory();
ISimpleChemObjectReader reader = readerFactory.createReader(new FileReader(input));
if (reader == null) { // see if it's a SMI file
if (filenames[i].endsWith(".smi")) {
reader = new SMILESReader(new FileReader(input));
}
}
IChemFile content = (IChemFile) reader.read(builder.newInstance(IChemFile.class));
if (content == null) continue;
List<IAtomContainer> c = ChemFileManipulator.getAllAtomContainers(content);
// we should do this loop in case we have files
// that contain multiple molecules
v.addAll(c);
}
} catch (Exception e) {
e.printStackTrace();
throw new CDKException(e.toString());
}
// convert the vector to a simple array
IAtomContainer[] retValues = new IAtomContainer[v.size()];
for (int i = 0; i < v.size(); i++) {
retValues[i] = v.get(i);
}
// before returning, lets make see if we
// need to perceive aromaticity and atom typing
if (doAromaticity) {
for (int i = 0; i < retValues.length; i++) {
try {
CDKHueckelAromaticityDetector.detectAromaticity(retValues[i]);
} catch (CDKException e) {
retValues[i] = null;
}
}
}
if (doTyping) {
for (int i = 0; i < retValues.length; i++) {
try {
AtomContainerManipulator.percieveAtomTypesAndConfigureAtoms(retValues[i]);
} catch (CDKException e) {
retValues[i] = null;
}
}
}
if (doIsotopes) {
IsotopeFactory ifac = IsotopeFactory.getInstance(DefaultChemObjectBuilder.getInstance());
for (IAtomContainer retValue : retValues) {
ifac.configureAtoms(retValue);
}
}
return retValues;
}
/**
* Calculates the 3 MI's, 3 ration and the R_gyr value.
*
* <p>The molecule should have hydrogens
*
* @param container Parameter is the atom container.
* @return An ArrayList containing 7 elements in the order described above
*/
@TestMethod("testCalculate_IAtomContainer")
public DescriptorValue calculate(IAtomContainer container) {
if (!GeometryTools.has3DCoordinates(container))
return getDummyDescriptorValue(new CDKException("Molecule must have 3D coordinates"));
IAtomContainer clone;
IsotopeFactory factory;
try {
clone = (IAtomContainer) container.clone();
factory = IsotopeFactory.getInstance(container.getBuilder());
factory.configureAtoms(clone);
} catch (Exception e) {
logger.debug(e);
return getDummyDescriptorValue(e);
}
DoubleArrayResult retval = new DoubleArrayResult(7);
double ccf = 1.000138;
double eps = 1e-5;
double[][] imat = new double[3][3];
Point3d centerOfMass = GeometryTools.get3DCentreOfMass(clone);
double xdif;
double ydif;
double zdif;
double xsq;
double ysq;
double zsq;
for (int i = 0; i < clone.getAtomCount(); i++) {
IAtom currentAtom = clone.getAtom(i);
double mass = factory.getMajorIsotope(currentAtom.getSymbol()).getExactMass();
xdif = currentAtom.getPoint3d().x - centerOfMass.x;
ydif = currentAtom.getPoint3d().y - centerOfMass.y;
zdif = currentAtom.getPoint3d().z - centerOfMass.z;
xsq = xdif * xdif;
ysq = ydif * ydif;
zsq = zdif * zdif;
imat[0][0] += mass * (ysq + zsq);
imat[1][1] += mass * (xsq + zsq);
imat[2][2] += mass * (xsq + ysq);
imat[1][0] += -1 * mass * ydif * xdif;
imat[0][1] = imat[1][0];
imat[2][0] += -1 * mass * xdif * zdif;
imat[0][2] = imat[2][0];
imat[2][1] += -1 * mass * ydif * zdif;
imat[1][2] = imat[2][1];
}
// diagonalize the MI tensor
Matrix tmp = new Matrix(imat);
EigenvalueDecomposition eigenDecomp = tmp.eig();
double[] eval = eigenDecomp.getRealEigenvalues();
retval.add(eval[2]);
retval.add(eval[1]);
retval.add(eval[0]);
double etmp = eval[0];
eval[0] = eval[2];
eval[2] = etmp;
if (Math.abs(eval[1]) > 1e-3) retval.add(eval[0] / eval[1]);
else retval.add(1000);
if (Math.abs(eval[2]) > 1e-3) {
retval.add(eval[0] / eval[2]);
retval.add(eval[1] / eval[2]);
} else {
retval.add(1000);
retval.add(1000);
}
// finally get the radius of gyration
double pri;
IMolecularFormula formula = MolecularFormulaManipulator.getMolecularFormula(clone);
if (Math.abs(eval[2]) > eps) pri = Math.pow(eval[0] * eval[1] * eval[2], 1.0 / 3.0);
else pri = Math.sqrt(eval[0] * ccf / MolecularFormulaManipulator.getTotalExactMass(formula));
retval.add(
Math.sqrt(
Math.PI * 2 * pri * ccf / MolecularFormulaManipulator.getTotalExactMass(formula)));
return new DescriptorValue(
getSpecification(), getParameterNames(), getParameters(), retval, getDescriptorNames());
}
/** A unit test for JUnit */
@Test
public void testDoubleBondConfiguration() throws Exception {
HydrogenPlacer hydrogenPlacer = new HydrogenPlacer();
IAtomContainer mol1 = new AtomContainer();
SmilesGenerator sg = new SmilesGenerator();
mol1.addAtom(new Atom("S", new Point2d(0, 0)));
// 1
mol1.addAtom(new Atom("C", new Point2d(1, 1)));
// 2
mol1.addAtom(new Atom("F", new Point2d(2, 0)));
// 3
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 4
mol1.addAtom(new Atom("F", new Point2d(2, 3)));
// 5
mol1.addAtom(new Atom("S", new Point2d(0, 3)));
// 1
mol1.addBond(0, 1, IBond.Order.SINGLE);
// 1
mol1.addBond(1, 2, IBond.Order.SINGLE);
// 2
mol1.addBond(1, 3, IBond.Order.DOUBLE);
// 3
mol1.addBond(3, 4, IBond.Order.SINGLE);
// 4
mol1.addBond(3, 5, IBond.Order.SINGLE);
// 4
try {
IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder());
ifac.configureAtoms(mol1);
} catch (IOException ex) {
}
String smiles1 = null;
if (standAlone) {
display(mol1);
}
boolean[] bool = new boolean[mol1.getBondCount()];
bool[2] = true;
try {
smiles1 = sg.createSMILES(mol1, true, bool);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
if (standAlone) {
System.err.println("SMILES 1: " + smiles1);
}
Assert.assertNotNull(smiles1);
Assert.assertEquals("F/C(=C/(F)S)S", smiles1);
mol1.getAtom(4).setPoint2d(new Point2d(0, 3));
mol1.getAtom(5).setPoint2d(new Point2d(2, 3));
try {
smiles1 = sg.createSMILES(mol1, true, bool);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
if (standAlone) {
System.err.println("SMILES 1: " + smiles1);
}
Assert.assertNotNull(smiles1);
Assert.assertEquals("F/C(=C\\(F)S)S", smiles1);
try {
addExplicitHydrogens(mol1);
hydrogenPlacer.placeHydrogens2D(mol1, 1.0);
} catch (IOException ex) {
} catch (ClassNotFoundException ex) {
}
bool = new boolean[mol1.getBondCount()];
bool[2] = true;
try {
smiles1 = sg.createSMILES(mol1, true, bool);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
Assert.assertEquals("[H]S/C(F)=C/(F)S[H]", smiles1);
mol1.getAtom(5).setPoint2d(new Point2d(0, 3));
mol1.getAtom(4).setPoint2d(new Point2d(2, 3));
try {
smiles1 = sg.createSMILES(mol1, true, bool);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
Assert.assertEquals("[H]S/C(F)=C\\(F)S[H]", smiles1);
}
/** A unit test for JUnit */
@Test
public void testCisTransDecalin() throws Exception {
HydrogenPlacer hydrogenPlacer = new HydrogenPlacer();
IAtomContainer mol1 = new AtomContainer();
SmilesGenerator sg = new SmilesGenerator();
mol1.addAtom(new Atom("H", new Point2d(1, 0)));
// 1
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 2
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 3
mol1.addAtom(new Atom("C", new Point2d(0, 0)));
// 4
mol1.addAtom(new Atom("C", new Point2d(1, 4)));
// 5
mol1.addAtom(new Atom("C", new Point2d(1, 5)));
// 6
mol1.addAtom(new Atom("C", new Point2d(1, 6)));
// 7
mol1.addAtom(new Atom("H", new Point2d(1, 0)));
// 1
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 2
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 3
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 2
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 3
mol1.addBond(0, 1, IBond.Order.SINGLE, IBond.Stereo.DOWN);
// 1
mol1.addBond(1, 2, IBond.Order.SINGLE);
// 2
mol1.addBond(2, 3, IBond.Order.SINGLE);
// 3
mol1.addBond(3, 4, IBond.Order.SINGLE);
// 4
mol1.addBond(4, 5, IBond.Order.SINGLE);
// 5
mol1.addBond(5, 6, IBond.Order.SINGLE);
// 6
mol1.addBond(6, 7, IBond.Order.SINGLE, IBond.Stereo.DOWN);
// 3
mol1.addBond(6, 8, IBond.Order.SINGLE);
// 4
mol1.addBond(8, 9, IBond.Order.SINGLE);
// 5
mol1.addBond(9, 10, IBond.Order.SINGLE);
// 6
mol1.addBond(10, 11, IBond.Order.SINGLE);
// 6
mol1.addBond(11, 1, IBond.Order.SINGLE);
// 6
mol1.addBond(1, 6, IBond.Order.SINGLE);
// 6
try {
addExplicitHydrogens(mol1);
hydrogenPlacer.placeHydrogens2D(mol1, 1.0);
IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder());
ifac.configureAtoms(mol1);
} catch (IOException ex) {
} catch (ClassNotFoundException ex) {
}
String smiles1 = null;
if (standAlone) {
display(mol1);
}
try {
smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
if (standAlone) {
System.err.println("SMILES 1: " + smiles1);
}
Assert.assertNotNull(smiles1);
Assert.assertEquals(
"[H]C1([H])(C([H])([H])C([H])([H])C\\2([H])(C([H])([H])C([H])([H])C([H])([H])C([H])([H])C\\2([H])(C1([H])([H]))))",
smiles1);
mol1.getBond(6).setStereo(IBond.Stereo.UP);
String smiles3 = null;
try {
smiles3 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
Assert.assertNotSame(smiles3, smiles1);
}
/** A unit test for JUnit */
@Test
public void testCisResorcinol() throws Exception {
HydrogenPlacer hydrogenPlacer = new HydrogenPlacer();
IAtomContainer mol1 = new AtomContainer();
SmilesGenerator sg = new SmilesGenerator();
mol1.addAtom(new Atom("O", new Point2d(3, 1)));
// 1
mol1.addAtom(new Atom("H", new Point2d(2, 0)));
// 2
mol1.addAtom(new Atom("C", new Point2d(2, 1)));
// 3
mol1.addAtom(new Atom("C", new Point2d(1, 1)));
// 4
mol1.addAtom(new Atom("C", new Point2d(1, 4)));
// 5
mol1.addAtom(new Atom("C", new Point2d(1, 5)));
// 6
mol1.addAtom(new Atom("C", new Point2d(1, 2)));
// 7
mol1.addAtom(new Atom("C", new Point2d(2, 2)));
// 1
mol1.addAtom(new Atom("O", new Point2d(3, 2)));
// 2
mol1.addAtom(new Atom("H", new Point2d(2, 3)));
// 3
mol1.addBond(0, 2, IBond.Order.SINGLE, IBond.Stereo.DOWN);
// 1
mol1.addBond(1, 2, IBond.Order.SINGLE, IBond.Stereo.UP);
// 2
mol1.addBond(2, 3, IBond.Order.SINGLE);
// 3
mol1.addBond(3, 4, IBond.Order.SINGLE);
// 4
mol1.addBond(4, 5, IBond.Order.SINGLE);
// 5
mol1.addBond(5, 6, IBond.Order.SINGLE);
// 6
mol1.addBond(6, 7, IBond.Order.SINGLE);
// 3
mol1.addBond(7, 8, IBond.Order.SINGLE, IBond.Stereo.UP);
// 4
mol1.addBond(7, 9, IBond.Order.SINGLE, IBond.Stereo.DOWN);
// 5
mol1.addBond(7, 2, IBond.Order.SINGLE);
// 6
try {
addExplicitHydrogens(mol1);
hydrogenPlacer.placeHydrogens2D(mol1, 1.0);
IsotopeFactory ifac = IsotopeFactory.getInstance(mol1.getBuilder());
ifac.configureAtoms(mol1);
} catch (IOException ex) {
} catch (ClassNotFoundException ex) {
}
String smiles1 = null;
if (standAlone) {
display(mol1);
}
try {
smiles1 = sg.createSMILES(mol1, true, new boolean[mol1.getBondCount()]);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
if (standAlone) {
System.err.println("SMILES 1: " + smiles1);
}
Assert.assertNotNull(smiles1);
Assert.assertEquals(
"[H]O[C@]1(C([H])([H])C([H])([H])C([H])([H])C([H])([H])[C@]1(O[H])([H]))([H])", smiles1);
mol1 = AtomContainerManipulator.removeHydrogens(mol1);
try {
smiles1 = sg.createSMILES(mol1);
} catch (Exception exc) {
System.out.println(exc);
if (!standAlone) {
Assert.fail();
}
}
if (standAlone) {
System.err.println("SMILES 1: " + smiles1);
}
Assert.assertNotNull(smiles1);
Assert.assertEquals("OC1CCCCC1(O)", smiles1);
}
/**
* Read an IAtomContainer from a file in MDL sd format
*
* @return The Molecule that was read from the MDL file.
*/
private IAtomContainer readAtomContainer(IAtomContainer molecule) throws CDKException {
logger.debug("Reading new molecule");
IAtomContainer outputContainer = null;
int linecount = 0;
int atoms = 0;
int bonds = 0;
int atom1 = 0;
int atom2 = 0;
int order = 0;
IBond.Stereo stereo = (IBond.Stereo) CDKConstants.UNSET;
int RGroupCounter = 1;
int Rnumber = 0;
String[] rGroup = null;
double x = 0.0;
double y = 0.0;
double z = 0.0;
double totalX = 0.0;
double totalY = 0.0;
double totalZ = 0.0;
String title = null;
String remark = null;
// int[][] conMat = new int[0][0];
// String help;
IAtom atom;
String line = "";
// A map to keep track of R# atoms so that RGP line can be parsed
Map<Integer, IPseudoAtom> rAtoms = new HashMap<Integer, IPseudoAtom>();
try {
IsotopeFactory isotopeFactory = Isotopes.getInstance();
logger.info("Reading header");
line = input.readLine();
linecount++;
if (line == null) {
return null;
}
logger.debug("Line " + linecount + ": " + line);
if (line.startsWith("$$$$")) {
logger.debug("File is empty, returning empty molecule");
return molecule;
}
if (line.length() > 0) {
title = line;
}
line = input.readLine();
linecount++;
logger.debug("Line " + linecount + ": " + line);
line = input.readLine();
linecount++;
logger.debug("Line " + linecount + ": " + line);
if (line.length() > 0) {
remark = line;
}
logger.info("Reading rest of file");
line = input.readLine();
linecount++;
logger.debug("Line " + linecount + ": " + line);
// if the line is empty we hav a problem - either a malformed
// molecule entry or just extra new lines at the end of the file
if (line.length() == 0) {
// read till the next $$$$ or EOF
while (true) {
line = input.readLine();
linecount++;
if (line == null) {
return null;
}
if (line.startsWith("$$$$")) {
return molecule; // an empty molecule
}
}
}
// check the CT block version
if (line.contains("V3000") || line.contains("v3000")) {
handleError("This file must be read with the MDLV3000Reader.");
} else if (!line.contains("V2000") && !line.contains("v2000")) {
handleError("This file must be read with the MDLReader.");
}
atoms = Integer.parseInt(line.substring(0, 3).trim());
List<IAtom> atomList = new ArrayList<IAtom>();
logger.debug("Atomcount: " + atoms);
bonds = Integer.parseInt(line.substring(3, 6).trim());
logger.debug("Bondcount: " + bonds);
List<IBond> bondList = new ArrayList<IBond>();
// used for applying the MDL valence model
int[] explicitValence = new int[atoms];
// read ATOM block
logger.info("Reading atom block");
atomsByLinePosition = new ArrayList<IAtom>();
atomsByLinePosition.add(null); // 0 is not a valid position
int atomBlockLineNumber = 0;
for (int f = 0; f < atoms; f++) {
line = input.readLine();
linecount++;
atomBlockLineNumber++;
Matcher trailingSpaceMatcher = TRAILING_SPACE.matcher(line);
if (trailingSpaceMatcher.find()) {
handleError(
"Trailing space found",
linecount,
trailingSpaceMatcher.start(),
trailingSpaceMatcher.end());
line = trailingSpaceMatcher.replaceAll("");
}
x = Double.parseDouble(line.substring(0, 10).trim());
y = Double.parseDouble(line.substring(10, 20).trim());
z = Double.parseDouble(line.substring(20, 30).trim());
// *all* values should be zero, not just the sum
totalX += Math.abs(x);
totalY += Math.abs(y);
totalZ += Math.abs(z);
logger.debug("Coordinates: " + x + "; " + y + "; " + z);
String element = line.substring(31, Math.min(line.length(), 34)).trim();
if (line.length() < 34) {
handleError(
"Element atom type does not follow V2000 format type should of length three"
+ " and padded with space if required",
linecount,
31,
34);
}
logger.debug("Atom type: ", element);
if (isotopeFactory.isElement(element)) {
atom = isotopeFactory.configure(molecule.getBuilder().newInstance(IAtom.class, element));
} else if ("A".equals(element)) {
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
} else if ("Q".equals(element)) {
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
} else if ("*".equals(element)) {
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
} else if ("LP".equals(element)) {
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
} else if ("L".equals(element)) {
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
} else if (element.equals("R") || (element.length() > 0 && element.charAt(0) == 'R')) {
logger.debug("Atom ", element, " is not an regular element. Creating a PseudoAtom.");
// check if the element is R
rGroup = element.split("^R");
atom = null;
if (rGroup.length > 1) {
try {
Rnumber = Integer.valueOf(rGroup[(rGroup.length - 1)]);
RGroupCounter = Rnumber;
element = "R" + Rnumber;
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
} catch (Exception ex) {
// This happens for atoms labeled "R#".
// The Rnumber may be set later on, using RGP line
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, "R");
rAtoms.put(atomBlockLineNumber, (IPseudoAtom) atom);
}
} else {
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
}
} else {
handleError(
"Invalid element type. Must be an existing " + "element, or one in: A, Q, L, LP, *.",
linecount,
32,
35);
atom = molecule.getBuilder().newInstance(IPseudoAtom.class, element);
atom.setSymbol(element);
}
// store as 3D for now, convert to 2D (if totalZ == 0.0) later
atom.setPoint3d(new Point3d(x, y, z));
// parse further fields
if (line.length() >= 36) {
String massDiffString = line.substring(34, 36).trim();
logger.debug("Mass difference: ", massDiffString);
if (!(atom instanceof IPseudoAtom)) {
try {
int massDiff = Integer.parseInt(massDiffString);
if (massDiff != 0) {
IIsotope major = Isotopes.getInstance().getMajorIsotope(element);
atom.setMassNumber(major.getMassNumber() + massDiff);
}
} catch (Exception exception) {
handleError("Could not parse mass difference field.", linecount, 35, 37, exception);
}
} else {
logger.error("Cannot set mass difference for a non-element!");
}
} else {
handleError("Mass difference is missing", linecount, 34, 36);
}
// set the stereo partiy
Integer parity = line.length() > 41 ? Character.digit(line.charAt(41), 10) : 0;
atom.setStereoParity(parity);
if (line.length() >= 51) {
String valenceString = removeNonDigits(line.substring(48, 51));
logger.debug("Valence: ", valenceString);
if (!(atom instanceof IPseudoAtom)) {
try {
int valence = Integer.parseInt(valenceString);
if (valence != 0) {
// 15 is defined as 0 in mol files
if (valence == 15) atom.setValency(0);
else atom.setValency(valence);
}
} catch (Exception exception) {
handleError(
"Could not parse valence information field", linecount, 49, 52, exception);
}
} else {
logger.error("Cannot set valence information for a non-element!");
}
}
if (line.length() >= 39) {
String chargeCodeString = line.substring(36, 39).trim();
logger.debug("Atom charge code: ", chargeCodeString);
int chargeCode = Integer.parseInt(chargeCodeString);
if (chargeCode == 0) {
// uncharged species
} else if (chargeCode == 1) {
atom.setFormalCharge(+3);
} else if (chargeCode == 2) {
atom.setFormalCharge(+2);
} else if (chargeCode == 3) {
atom.setFormalCharge(+1);
} else if (chargeCode == 4) {
} else if (chargeCode == 5) {
atom.setFormalCharge(-1);
} else if (chargeCode == 6) {
atom.setFormalCharge(-2);
} else if (chargeCode == 7) {
atom.setFormalCharge(-3);
}
} else {
handleError("Atom charge is missing", linecount, 36, 39);
}
try {
// read the mmm field as position 61-63
String reactionAtomIDString = line.substring(60, 63).trim();
logger.debug("Parsing mapping id: ", reactionAtomIDString);
try {
int reactionAtomID = Integer.parseInt(reactionAtomIDString);
if (reactionAtomID != 0) {
atom.setProperty(CDKConstants.ATOM_ATOM_MAPPING, reactionAtomID);
}
} catch (Exception exception) {
logger.error("Mapping number ", reactionAtomIDString, " is not an integer.");
logger.debug(exception);
}
} catch (Exception exception) {
// older mol files don't have all these fields...
logger.warn("A few fields are missing. Older MDL MOL file?");
}
// shk3: This reads shifts from after the molecule. I don't think this is an official
// format, but I saw it frequently 80=>78 for alk
if (line.length() >= 78) {
double shift = Double.parseDouble(line.substring(69, 80).trim());
atom.setProperty("first shift", shift);
}
if (line.length() >= 87) {
double shift = Double.parseDouble(line.substring(79, 87).trim());
atom.setProperty("second shift", shift);
}
atomList.add(atom);
atomsByLinePosition.add(atom);
}
// convert to 2D, if totalZ == 0
if (totalX == 0.0 && totalY == 0.0 && totalZ == 0.0) {
logger.info("All coordinates are 0.0");
if (atomList.size() == 1) {
atomList.get(0).setPoint2d(new Point2d(x, y));
} else {
for (IAtom atomToUpdate : atomList) {
atomToUpdate.setPoint3d(null);
}
}
} else if (totalZ == 0.0 && !forceReadAs3DCoords.isSet()) {
logger.info("Total 3D Z is 0.0, interpreting it as a 2D structure");
for (IAtom atomToUpdate : atomList) {
Point3d p3d = atomToUpdate.getPoint3d();
if (p3d != null) {
atomToUpdate.setPoint2d(new Point2d(p3d.x, p3d.y));
atomToUpdate.setPoint3d(null);
}
}
}
// read BOND block
logger.info("Reading bond block");
int queryBondCount = 0;
for (int f = 0; f < bonds; f++) {
line = input.readLine();
linecount++;
atom1 = Integer.parseInt(line.substring(0, 3).trim());
atom2 = Integer.parseInt(line.substring(3, 6).trim());
order = Integer.parseInt(line.substring(6, 9).trim());
if (line.length() >= 12) {
int mdlStereo =
line.length() > 12
? Integer.parseInt(line.substring(9, 12).trim())
: Integer.parseInt(line.substring(9).trim());
if (mdlStereo == 1) {
// MDL up bond
stereo = IBond.Stereo.UP;
} else if (mdlStereo == 6) {
// MDL down bond
stereo = IBond.Stereo.DOWN;
} else if (mdlStereo == 0) {
if (order == 2) {
// double bond stereo defined by coordinates
stereo = IBond.Stereo.E_Z_BY_COORDINATES;
} else {
// bond has no stereochemistry
stereo = IBond.Stereo.NONE;
}
} else if (mdlStereo == 3 && order == 2) {
// unknown E/Z stereochemistry
stereo = IBond.Stereo.E_OR_Z;
} else if (mdlStereo == 4) {
// MDL bond undefined
stereo = IBond.Stereo.UP_OR_DOWN;
}
} else {
handleError("Missing expected stereo field at line: ", linecount, 10, 12);
}
if (logger.isDebugEnabled()) {
logger.debug("Bond: " + atom1 + " - " + atom2 + "; order " + order);
}
// interpret CTfile's special bond orders
IAtom a1 = atomList.get(atom1 - 1);
IAtom a2 = atomList.get(atom2 - 1);
IBond newBond = null;
if (order >= 1 && order <= 3) {
IBond.Order cdkOrder = IBond.Order.SINGLE;
if (order == 2) cdkOrder = IBond.Order.DOUBLE;
if (order == 3) cdkOrder = IBond.Order.TRIPLE;
if (stereo != null) {
newBond = molecule.getBuilder().newInstance(IBond.class, a1, a2, cdkOrder, stereo);
} else {
newBond = molecule.getBuilder().newInstance(IBond.class, a1, a2, cdkOrder);
}
} else if (order == 4) {
// aromatic bond
if (stereo != null) {
newBond =
molecule.getBuilder().newInstance(IBond.class, a1, a2, IBond.Order.UNSET, stereo);
} else {
newBond = molecule.getBuilder().newInstance(IBond.class, a1, a2, IBond.Order.UNSET);
}
// mark both atoms and the bond as aromatic and raise the SINGLE_OR_DOUBLE-flag
newBond.setFlag(CDKConstants.SINGLE_OR_DOUBLE, true);
newBond.setFlag(CDKConstants.ISAROMATIC, true);
a1.setFlag(CDKConstants.ISAROMATIC, true);
a2.setFlag(CDKConstants.ISAROMATIC, true);
} else {
queryBondCount++;
newBond = new CTFileQueryBond(molecule.getBuilder());
IAtom[] bondAtoms = {a1, a2};
newBond.setAtoms(bondAtoms);
newBond.setOrder(null);
CTFileQueryBond.Type queryBondType = null;
switch (order) {
case 5:
queryBondType = CTFileQueryBond.Type.SINGLE_OR_DOUBLE;
break;
case 6:
queryBondType = CTFileQueryBond.Type.SINGLE_OR_AROMATIC;
break;
case 7:
queryBondType = CTFileQueryBond.Type.DOUBLE_OR_AROMATIC;
break;
case 8:
queryBondType = CTFileQueryBond.Type.ANY;
break;
}
((CTFileQueryBond) newBond).setType(queryBondType);
newBond.setStereo(stereo);
}
bondList.add((newBond));
// add the bond order to the explicit valence for each atom
if (newBond.getOrder() != null && newBond.getOrder() != IBond.Order.UNSET) {
explicitValence[atom1 - 1] += newBond.getOrder().numeric();
explicitValence[atom2 - 1] += newBond.getOrder().numeric();
} else {
explicitValence[atom1 - 1] = Integer.MIN_VALUE;
explicitValence[atom2 - 1] = Integer.MIN_VALUE;
}
}
if (queryBondCount == 0) outputContainer = molecule;
else {
outputContainer = new QueryAtomContainer(molecule.getBuilder());
}
outputContainer.setProperty(CDKConstants.TITLE, title);
outputContainer.setProperty(CDKConstants.REMARK, remark);
for (IAtom at : atomList) {
outputContainer.addAtom(at);
}
for (IBond bnd : bondList) {
outputContainer.addBond(bnd);
}
// read PROPERTY block
logger.info("Reading property block");
while (true) {
line = input.readLine();
linecount++;
if (line == null) {
handleError("The expected property block is missing!", linecount, 0, 0);
}
if (line.startsWith("M END")) break;
boolean lineRead = false;
if (line.startsWith("M CHG")) {
// FIXME: if this is encountered for the first time, all
// atom charges should be set to zero first!
int infoCount = Integer.parseInt(line.substring(6, 9).trim());
StringTokenizer st = new StringTokenizer(line.substring(9));
for (int i = 1; i <= infoCount; i++) {
String token = st.nextToken();
int atomNumber = Integer.parseInt(token.trim());
token = st.nextToken();
int charge = Integer.parseInt(token.trim());
outputContainer.getAtom(atomNumber - 1).setFormalCharge(charge);
}
} else if (line.matches("A\\s{1,4}\\d+")) {
// Reads the pseudo atom property from the mol file
// The atom number of the to replaced atom
int aliasAtomNumber =
Integer.parseInt(line.replaceFirst("A\\s{1,4}", "")) - RGroupCounter;
line = input.readLine();
linecount++;
String[] aliasArray = line.split("\\\\");
// name of the alias atom like R1 or R2 etc.
String alias = "";
for (int i = 0; i < aliasArray.length; i++) {
alias += aliasArray[i];
}
IAtom aliasAtom = outputContainer.getAtom(aliasAtomNumber);
// skip if already a pseudoatom
if (aliasAtom instanceof IPseudoAtom) {
((IPseudoAtom) aliasAtom).setLabel(alias);
continue;
}
IAtom newPseudoAtom = molecule.getBuilder().newInstance(IPseudoAtom.class, alias);
if (aliasAtom.getPoint2d() != null) {
newPseudoAtom.setPoint2d(aliasAtom.getPoint2d());
}
if (aliasAtom.getPoint3d() != null) {
newPseudoAtom.setPoint3d(aliasAtom.getPoint3d());
}
outputContainer.addAtom(newPseudoAtom);
List<IBond> bondsOfAliasAtom = outputContainer.getConnectedBondsList(aliasAtom);
for (int i = 0; i < bondsOfAliasAtom.size(); i++) {
IBond bondOfAliasAtom = bondsOfAliasAtom.get(i);
IAtom connectedToAliasAtom = bondOfAliasAtom.getConnectedAtom(aliasAtom);
IBond newBond = bondOfAliasAtom.getBuilder().newInstance(IBond.class);
newBond.setAtoms(new IAtom[] {connectedToAliasAtom, newPseudoAtom});
newBond.setOrder(bondOfAliasAtom.getOrder());
outputContainer.addBond(newBond);
outputContainer.removeBond(aliasAtom, connectedToAliasAtom);
}
outputContainer.removeAtom(aliasAtom);
RGroupCounter++;
} else if (line.startsWith("M ISO")) {
try {
String countString = line.substring(6, 10).trim();
int infoCount = Integer.parseInt(countString);
StringTokenizer st = new StringTokenizer(line.substring(10));
for (int i = 1; i <= infoCount; i++) {
int atomNumber = Integer.parseInt(st.nextToken().trim());
int absMass = Integer.parseInt(st.nextToken().trim());
if (absMass != 0) {
IAtom isotope = outputContainer.getAtom(atomNumber - 1);
isotope.setMassNumber(absMass);
}
}
} catch (NumberFormatException exception) {
String error =
"Error ("
+ exception.getMessage()
+ ") while parsing line "
+ linecount
+ ": "
+ line
+ " in property block.";
logger.error(error);
handleError(
"NumberFormatException in isotope information.", linecount, 7, 11, exception);
}
} else if (line.startsWith("M RAD")) {
try {
String countString = line.substring(6, 9).trim();
int infoCount = Integer.parseInt(countString);
StringTokenizer st = new StringTokenizer(line.substring(9));
for (int i = 1; i <= infoCount; i++) {
int atomNumber = Integer.parseInt(st.nextToken().trim());
int spinMultiplicity = Integer.parseInt(st.nextToken().trim());
MDLV2000Writer.SPIN_MULTIPLICITY spin = MDLV2000Writer.SPIN_MULTIPLICITY.NONE;
if (spinMultiplicity > 0) {
IAtom radical = outputContainer.getAtom(atomNumber - 1);
switch (spinMultiplicity) {
case 1:
spin = MDLV2000Writer.SPIN_MULTIPLICITY.DOUBLET;
break;
case 2:
spin = MDLV2000Writer.SPIN_MULTIPLICITY.SINGLET;
break;
case 3:
spin = MDLV2000Writer.SPIN_MULTIPLICITY.TRIPLET;
break;
default:
logger.debug("Invalid spin multiplicity found: " + spinMultiplicity);
break;
}
for (int j = 0; j < spin.getSingleElectrons(); j++) {
outputContainer.addSingleElectron(
molecule.getBuilder().newInstance(ISingleElectron.class, radical));
}
}
}
} catch (NumberFormatException exception) {
String error =
"Error ("
+ exception.getMessage()
+ ") while parsing line "
+ linecount
+ ": "
+ line
+ " in property block.";
logger.error(error);
handleError(
"NumberFormatException in radical information", linecount, 7, 10, exception);
}
} else if (line.startsWith("G ")) {
try {
String atomNumberString = line.substring(3, 6).trim();
int atomNumber = Integer.parseInt(atomNumberString);
// String whatIsThisString = line.substring(6,9).trim();
String atomName = input.readLine();
// convert Atom into a PseudoAtom
IAtom prevAtom = outputContainer.getAtom(atomNumber - 1);
IPseudoAtom pseudoAtom = molecule.getBuilder().newInstance(IPseudoAtom.class, atomName);
if (prevAtom.getPoint2d() != null) {
pseudoAtom.setPoint2d(prevAtom.getPoint2d());
}
if (prevAtom.getPoint3d() != null) {
pseudoAtom.setPoint3d(prevAtom.getPoint3d());
}
AtomContainerManipulator.replaceAtomByAtom(molecule, prevAtom, pseudoAtom);
} catch (NumberFormatException exception) {
String error =
"Error ("
+ exception.toString()
+ ") while parsing line "
+ linecount
+ ": "
+ line
+ " in property block.";
logger.error(error);
handleError("NumberFormatException in group information", linecount, 4, 7, exception);
}
} else if (line.startsWith("M RGP")) {
StringTokenizer st = new StringTokenizer(line);
// Ignore first 3 tokens (overhead).
st.nextToken();
st.nextToken();
st.nextToken();
// Process the R group numbers as defined in RGP line.
while (st.hasMoreTokens()) {
Integer position = new Integer(st.nextToken());
Rnumber = new Integer(st.nextToken());
IPseudoAtom pseudoAtom = rAtoms.get(position);
if (pseudoAtom != null) {
pseudoAtom.setLabel("R" + Rnumber);
}
}
}
if (line.startsWith("V ")) {
Integer atomNumber = new Integer(line.substring(3, 6).trim());
IAtom atomWithComment = outputContainer.getAtom(atomNumber - 1);
atomWithComment.setProperty(CDKConstants.COMMENT, line.substring(7));
}
if (!lineRead) {
logger.warn("Skipping line in property block: ", line);
}
}
if (interpretHydrogenIsotopes.isSet()) {
fixHydrogenIsotopes(molecule, isotopeFactory);
}
// note: apply the valence model last so that all fixes (i.e. hydrogen
// isotopes) are in place
for (int i = 0; i < atoms; i++) {
applyMDLValenceModel(outputContainer.getAtom(i), explicitValence[i]);
}
} catch (CDKException exception) {
String error =
"Error while parsing line " + linecount + ": " + line + " -> " + exception.getMessage();
logger.error(error);
logger.debug(exception);
throw exception;
} catch (Exception exception) {
exception.printStackTrace();
String error =
"Error while parsing line " + linecount + ": " + line + " -> " + exception.getMessage();
logger.error(error);
logger.debug(exception);
handleError("Error while parsing line: " + line, linecount, 0, 0, exception);
}
return outputContainer;
}